C37H44N4O3S — CID 143783139
acetylene;N-[3-[(3-methoxyphenyl)methylamino]propyl]-3-methyl-5-[(2R)-2-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]benzamide;toluene (PubChem CID 143783139) has the molecular formula C37H44N4O3S and a molecular weight of 624.85 g/mol. Its IUPAC name is acetylene;N-[3-[(3-methoxyphenyl)methylamino]propyl]-3-methyl-5-[(2R)-2-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]benzamide;toluene.
| Compound Name | acetylene;N-[3-[(3-methoxyphenyl)methylamino]propyl]-3-methyl-5-[(2R)-2-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]benzamide;toluene |
|---|---|
| PubChem CID | 143783139 |
| Molecular Formula | C37H44N4O3S |
| Molecular Weight | 624.85 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | acetylene;N-[3-[(3-methoxyphenyl)methylamino]propyl]-3-methyl-5-[(2R)-2-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]benzamide;toluene |
| SMILES | C#C.COc1cccc(CNCCCNC(=O)c2cc(C)cc(C(=O)N3CCC[C@@H]3c3nc(C)cs3)c2)c1.Cc1ccccc1 |
| InChI | InChI=1S/C28H34N4O3S.C7H8.C2H2/c1-19-13-22(26(33)30-11-6-10-29-17-21-7-4-8-24(15-21)35-3)16-23(14-19)28(34)32-12-5-9-25(32)27-31-20(2)18-36-27;1-7-5-3-2-4-6-7;1-2/h4,7-8,13-16,18,25,29H,5-6,9-12,17H2,1-3H3,(H,30,33);2-6H,1H3;1-2H/t25-;;/m1../s1 |
| InChIKey | ABFZHZALQKNEQW-KHZPMNTOSA-N |
| XLogP | 6.90 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.85 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|