C36H43F3N4O4 — CID 143783093
3-formyl-5-methoxy-N-[3-[[3-(trifluoromethyl)phenyl]methylamino]propyl]benzamide;4-methyl-2-(1-methylpyrrolidin-2-yl)-1,3-oxazole;toluene (PubChem CID 143783093) has the molecular formula C36H43F3N4O4 and a molecular weight of 652.76 g/mol. Its IUPAC name is 3-formyl-5-methoxy-N-[3-[[3-(trifluoromethyl)phenyl]methylamino]propyl]benzamide;4-methyl-2-(1-methylpyrrolidin-2-yl)-1,3-oxazole;toluene.
| Compound Name | 3-formyl-5-methoxy-N-[3-[[3-(trifluoromethyl)phenyl]methylamino]propyl]benzamide;4-methyl-2-(1-methylpyrrolidin-2-yl)-1,3-oxazole;toluene |
|---|---|
| PubChem CID | 143783093 |
| Molecular Formula | C36H43F3N4O4 |
| Molecular Weight | 652.76 g/mol |
| Exact Mass | 652.32 |
| IUPAC Name | 3-formyl-5-methoxy-N-[3-[[3-(trifluoromethyl)phenyl]methylamino]propyl]benzamide;4-methyl-2-(1-methylpyrrolidin-2-yl)-1,3-oxazole;toluene |
| SMILES | COc1cc(C=O)cc(C(=O)NCCCNCc2cccc(C(F)(F)F)c2)c1.Cc1ccccc1.Cc1coc(C2CCCN2C)n1 |
| InChI | InChI=1S/C20H21F3N2O3.C9H14N2O.C7H8/c1-28-18-10-15(13-26)8-16(11-18)19(27)25-7-3-6-24-12-14-4-2-5-17(9-14)20(21,22)23;1-7-6-12-9(10-7)8-4-3-5-11(8)2;1-7-5-3-2-4-6-7/h2,4-5,8-11,13,24H,3,6-7,12H2,1H3,(H,25,27);6,8H,3-5H2,1-2H3;2-6H,1H3 |
| InChIKey | MJGQINOFQKEGFA-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.76 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|