C34H40F3N5O3 — CID 143783057
5-formyl-N-[3-[[3-(trifluoromethyl)phenyl]methylamino]propyl]pyridine-3-carboxamide;4-methyl-2-(1-methylpyrrolidin-2-yl)-1,3-oxazole;toluene (PubChem CID 143783057) has the molecular formula C34H40F3N5O3 and a molecular weight of 623.72 g/mol. Its IUPAC name is 5-formyl-N-[3-[[3-(trifluoromethyl)phenyl]methylamino]propyl]pyridine-3-carboxamide;4-methyl-2-(1-methylpyrrolidin-2-yl)-1,3-oxazole;toluene.
| Compound Name | 5-formyl-N-[3-[[3-(trifluoromethyl)phenyl]methylamino]propyl]pyridine-3-carboxamide;4-methyl-2-(1-methylpyrrolidin-2-yl)-1,3-oxazole;toluene |
|---|---|
| PubChem CID | 143783057 |
| Molecular Formula | C34H40F3N5O3 |
| Molecular Weight | 623.72 g/mol |
| Exact Mass | 623.31 |
| IUPAC Name | 5-formyl-N-[3-[[3-(trifluoromethyl)phenyl]methylamino]propyl]pyridine-3-carboxamide;4-methyl-2-(1-methylpyrrolidin-2-yl)-1,3-oxazole;toluene |
| SMILES | Cc1ccccc1.Cc1coc(C2CCCN2C)n1.O=Cc1cncc(C(=O)NCCCNCc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H18F3N3O2.C9H14N2O.C7H8/c19-18(20,21)16-4-1-3-13(8-16)9-22-5-2-6-24-17(26)15-7-14(12-25)10-23-11-15;1-7-6-12-9(10-7)8-4-3-5-11(8)2;1-7-5-3-2-4-6-7/h1,3-4,7-8,10-12,22H,2,5-6,9H2,(H,24,26);6,8H,3-5H2,1-2H3;2-6H,1H3 |
| InChIKey | AXPXOIFOZYWFJC-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.72 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|