C34H42F2N4O2S — CID 143752291
N-[3-[[3-(1,1-difluoroethyl)phenyl]methylamino]propyl]-3-formylbenzamide;N,N-dimethyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine;toluene (PubChem CID 143752291) has the molecular formula C34H42F2N4O2S and a molecular weight of 608.80 g/mol. Its IUPAC name is N-[3-[[3-(1,1-difluoroethyl)phenyl]methylamino]propyl]-3-formylbenzamide;N,N-dimethyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine;toluene.
| Compound Name | N-[3-[[3-(1,1-difluoroethyl)phenyl]methylamino]propyl]-3-formylbenzamide;N,N-dimethyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine;toluene |
|---|---|
| PubChem CID | 143752291 |
| Molecular Formula | C34H42F2N4O2S |
| Molecular Weight | 608.80 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | N-[3-[[3-(1,1-difluoroethyl)phenyl]methylamino]propyl]-3-formylbenzamide;N,N-dimethyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine;toluene |
| SMILES | CC(F)(F)c1cccc(CNCCCNC(=O)c2cccc(C=O)c2)c1.Cc1ccccc1.Cc1csc(CN(C)C)n1 |
| InChI | InChI=1S/C20H22F2N2O2.C7H12N2S.C7H8/c1-20(21,22)18-8-3-5-15(12-18)13-23-9-4-10-24-19(26)17-7-2-6-16(11-17)14-25;1-6-5-10-7(8-6)4-9(2)3;1-7-5-3-2-4-6-7/h2-3,5-8,11-12,14,23H,4,9-10,13H2,1H3,(H,24,26);5H,4H2,1-3H3;2-6H,1H3 |
| InChIKey | GQFRAFWSPNSIDY-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.80 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|