C32H38Cl2N4O2S — CID 143752405
N-[3-[(3,5-dichlorophenyl)methylamino]propyl]-3-formylbenzamide;N,N-dimethyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine;toluene (PubChem CID 143752405) has the molecular formula C32H38Cl2N4O2S and a molecular weight of 613.66 g/mol. Its IUPAC name is N-[3-[(3,5-dichlorophenyl)methylamino]propyl]-3-formylbenzamide;N,N-dimethyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine;toluene.
| Compound Name | N-[3-[(3,5-dichlorophenyl)methylamino]propyl]-3-formylbenzamide;N,N-dimethyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine;toluene |
|---|---|
| PubChem CID | 143752405 |
| Molecular Formula | C32H38Cl2N4O2S |
| Molecular Weight | 613.66 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | N-[3-[(3,5-dichlorophenyl)methylamino]propyl]-3-formylbenzamide;N,N-dimethyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine;toluene |
| SMILES | Cc1ccccc1.Cc1csc(CN(C)C)n1.O=Cc1cccc(C(=O)NCCCNCc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C18H18Cl2N2O2.C7H12N2S.C7H8/c19-16-8-14(9-17(20)10-16)11-21-5-2-6-22-18(24)15-4-1-3-13(7-15)12-23;1-6-5-10-7(8-6)4-9(2)3;1-7-5-3-2-4-6-7/h1,3-4,7-10,12,21H,2,5-6,11H2,(H,22,24);5H,4H2,1-3H3;2-6H,1H3 |
| InChIKey | SQBGAZKJMBULTO-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.66 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|