C36H49N5O2S2 — CID 143752324
N,3-dimethyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide;N-[3-[[3-(methylaminosulfanyl)-5-propan-2-ylphenyl]methylamino]propyl]formamide;toluene (PubChem CID 143752324) has the molecular formula C36H49N5O2S2 and a molecular weight of 647.96 g/mol. Its IUPAC name is N,3-dimethyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide;N-[3-[[3-(methylaminosulfanyl)-5-propan-2-ylphenyl]methylamino]propyl]formamide;toluene.
| Compound Name | N,3-dimethyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide;N-[3-[[3-(methylaminosulfanyl)-5-propan-2-ylphenyl]methylamino]propyl]formamide;toluene |
|---|---|
| PubChem CID | 143752324 |
| Molecular Formula | C36H49N5O2S2 |
| Molecular Weight | 647.96 g/mol |
| Exact Mass | 647.33 |
| IUPAC Name | N,3-dimethyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide;N-[3-[[3-(methylaminosulfanyl)-5-propan-2-ylphenyl]methylamino]propyl]formamide;toluene |
| SMILES | CNSc1cc(CNCCCNC=O)cc(C(C)C)c1.Cc1cccc(C(=O)N(C)Cc2nc(C)cs2)c1.Cc1ccccc1 |
| InChI | InChI=1S/C15H25N3OS.C14H16N2OS.C7H8/c1-12(2)14-7-13(8-15(9-14)20-16-3)10-17-5-4-6-18-11-19;1-10-5-4-6-12(7-10)14(17)16(3)8-13-15-11(2)9-18-13;1-7-5-3-2-4-6-7/h7-9,11-12,16-17H,4-6,10H2,1-3H3,(H,18,19);4-7,9H,8H2,1-3H3;2-6H,1H3 |
| InChIKey | ZNVNDCFFXMVCCR-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.96 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|