C36H45N5O2S — CID 143752579
acetylene;1-N-[3-[(3-amino-5-propan-2-ylphenyl)methylamino]propyl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide;toluene (PubChem CID 143752579) has the molecular formula C36H45N5O2S and a molecular weight of 611.86 g/mol. Its IUPAC name is acetylene;1-N-[3-[(3-amino-5-propan-2-ylphenyl)methylamino]propyl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide;toluene.
| Compound Name | acetylene;1-N-[3-[(3-amino-5-propan-2-ylphenyl)methylamino]propyl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide;toluene |
|---|---|
| PubChem CID | 143752579 |
| Molecular Formula | C36H45N5O2S |
| Molecular Weight | 611.86 g/mol |
| Exact Mass | 611.33 |
| IUPAC Name | acetylene;1-N-[3-[(3-amino-5-propan-2-ylphenyl)methylamino]propyl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide;toluene |
| SMILES | C#C.Cc1ccccc1.Cc1csc(CN(C)C(=O)c2cccc(C(=O)NCCCNCc3cc(N)cc(C(C)C)c3)c2)n1 |
| InChI | InChI=1S/C27H35N5O2S.C7H8.C2H2/c1-18(2)23-11-20(12-24(28)14-23)15-29-9-6-10-30-26(33)21-7-5-8-22(13-21)27(34)32(4)16-25-31-19(3)17-35-25;1-7-5-3-2-4-6-7;1-2/h5,7-8,11-14,17-18,29H,6,9-10,15-16,28H2,1-4H3,(H,30,33);2-6H,1H3;1-2H |
| InChIKey | QVYOQJZDTHLOEG-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.86 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|