C24H31N3O4 — CID 143752566
[3-[[3-[(3-formylbenzoyl)amino]propylamino]methyl]-5-propan-2-ylphenyl] N,N-dimethylcarbamate (PubChem CID 143752566) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is [3-[[3-[(3-formylbenzoyl)amino]propylamino]methyl]-5-propan-2-ylphenyl] N,N-dimethylcarbamate.
| Compound Name | [3-[[3-[(3-formylbenzoyl)amino]propylamino]methyl]-5-propan-2-ylphenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 143752566 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | [3-[[3-[(3-formylbenzoyl)amino]propylamino]methyl]-5-propan-2-ylphenyl] N,N-dimethylcarbamate |
| SMILES | CC(C)c1cc(CNCCCNC(=O)c2cccc(C=O)c2)cc(OC(=O)N(C)C)c1 |
| InChI | InChI=1S/C24H31N3O4/c1-17(2)21-12-19(13-22(14-21)31-24(30)27(3)4)15-25-9-6-10-26-23(29)20-8-5-7-18(11-20)16-28/h5,7-8,11-14,16-17,25H,6,9-10,15H2,1-4H3,(H,26,29) |
| InChIKey | UPBXCLJMNVOKKR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|