C24H34N2O5 — CID 143859688
(4-formylphenyl) acetate;3-hydroxy-N-[3-(methylamino)propyl]benzamide;2-methylpropane (PubChem CID 143859688) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is (4-formylphenyl) acetate;3-hydroxy-N-[3-(methylamino)propyl]benzamide;2-methylpropane.
| Compound Name | (4-formylphenyl) acetate;3-hydroxy-N-[3-(methylamino)propyl]benzamide;2-methylpropane |
|---|---|
| PubChem CID | 143859688 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (4-formylphenyl) acetate;3-hydroxy-N-[3-(methylamino)propyl]benzamide;2-methylpropane |
| SMILES | CC(=O)Oc1ccc(C=O)cc1.CC(C)C.CNCCCNC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C11H16N2O2.C9H8O3.C4H10/c1-12-6-3-7-13-11(15)9-4-2-5-10(14)8-9;1-7(11)12-9-4-2-8(6-10)3-5-9;1-4(2)3/h2,4-5,8,12,14H,3,6-7H2,1H3,(H,13,15);2-6H,1H3;4H,1-3H3 |
| InChIKey | RIPAMZCECVCZLE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|