C34H41N5O3S — CID 143752403
N,N-dimethyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine;N-[3-[(3-formylbenzoyl)amino]propyl]-5-prop-1-en-2-ylpyridine-3-carboxamide;toluene (PubChem CID 143752403) has the molecular formula C34H41N5O3S and a molecular weight of 599.80 g/mol. Its IUPAC name is N,N-dimethyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine;N-[3-[(3-formylbenzoyl)amino]propyl]-5-prop-1-en-2-ylpyridine-3-carboxamide;toluene.
| Compound Name | N,N-dimethyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine;N-[3-[(3-formylbenzoyl)amino]propyl]-5-prop-1-en-2-ylpyridine-3-carboxamide;toluene |
|---|---|
| PubChem CID | 143752403 |
| Molecular Formula | C34H41N5O3S |
| Molecular Weight | 599.80 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | N,N-dimethyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine;N-[3-[(3-formylbenzoyl)amino]propyl]-5-prop-1-en-2-ylpyridine-3-carboxamide;toluene |
| SMILES | C=C(C)c1cncc(C(=O)NCCCNC(=O)c2cccc(C=O)c2)c1.Cc1ccccc1.Cc1csc(CN(C)C)n1 |
| InChI | InChI=1S/C20H21N3O3.C7H12N2S.C7H8/c1-14(2)17-10-18(12-21-11-17)20(26)23-8-4-7-22-19(25)16-6-3-5-15(9-16)13-24;1-6-5-10-7(8-6)4-9(2)3;1-7-5-3-2-4-6-7/h3,5-6,9-13H,1,4,7-8H2,2H3,(H,22,25)(H,23,26);5H,4H2,1-3H3;2-6H,1H3 |
| InChIKey | YRSVRKJQLZBAPH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.80 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|