C30H30N4O3S — CID 67514749
3-[[(2-benzyl-3-phenylpropanoyl)amino]carbamoyl]-N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide (PubChem CID 67514749) has the molecular formula C30H30N4O3S and a molecular weight of 526.66 g/mol. Its IUPAC name is 3-[[(2-benzyl-3-phenylpropanoyl)amino]carbamoyl]-N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide.
| Compound Name | 3-[[(2-benzyl-3-phenylpropanoyl)amino]carbamoyl]-N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 67514749 |
| Molecular Formula | C30H30N4O3S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 3-[[(2-benzyl-3-phenylpropanoyl)amino]carbamoyl]-N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide |
| SMILES | Cc1csc(CN(C)C(=O)c2cccc(C(=O)NNC(=O)C(Cc3ccccc3)Cc3ccccc3)c2)n1 |
| InChI | InChI=1S/C30H30N4O3S/c1-21-20-38-27(31-21)19-34(2)30(37)25-15-9-14-24(18-25)28(35)32-33-29(36)26(16-22-10-5-3-6-11-22)17-23-12-7-4-8-13-23/h3-15,18,20,26H,16-17,19H2,1-2H3,(H,32,35)(H,33,36) |
| InChIKey | DRIFCFRVYKYWQA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|