C34H38N4O4S — CID 45136833
1-N-[(1R,2S)-1-hydroxy-3-phenyl-1-[(2R,4R)-4-phenylmethoxypyrrolidin-2-yl]propan-2-yl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide (PubChem CID 45136833) has the molecular formula C34H38N4O4S and a molecular weight of 598.77 g/mol. Its IUPAC name is 1-N-[(1R,2S)-1-hydroxy-3-phenyl-1-[(2R,4R)-4-phenylmethoxypyrrolidin-2-yl]propan-2-yl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(1R,2S)-1-hydroxy-3-phenyl-1-[(2R,4R)-4-phenylmethoxypyrrolidin-2-yl]propan-2-yl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 45136833 |
| Molecular Formula | C34H38N4O4S |
| Molecular Weight | 598.77 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | 1-N-[(1R,2S)-1-hydroxy-3-phenyl-1-[(2R,4R)-4-phenylmethoxypyrrolidin-2-yl]propan-2-yl]-3-N-methyl-3-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzene-1,3-dicarboxamide |
| SMILES | Cc1csc(CN(C)C(=O)c2cccc(C(=O)N[C@@H](Cc3ccccc3)[C@H](O)[C@H]3C[C@@H](OCc4ccccc4)CN3)c2)n1 |
| InChI | InChI=1S/C34H38N4O4S/c1-23-22-43-31(36-23)20-38(2)34(41)27-15-9-14-26(17-27)33(40)37-30(16-24-10-5-3-6-11-24)32(39)29-18-28(19-35-29)42-21-25-12-7-4-8-13-25/h3-15,17,22,28-30,32,35,39H,16,18-21H2,1-2H3,(H,37,40)/t28-,29-,30+,32-/m1/s1 |
| InChIKey | LOJIVQKKGMCRMB-IBKYNAJHSA-N |
| XLogP | 4.37 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |