C36H48N4O5S — CID 143922005
N,N-dimethyl-1-(4-methyl-1,3-oxazol-2-yl)methanamine;3-formyl-N-[3-[(4-methoxyphenyl)sulfinyl-(2-methylpropyl)amino]propyl]benzamide;toluene (PubChem CID 143922005) has the molecular formula C36H48N4O5S and a molecular weight of 648.87 g/mol. Its IUPAC name is N,N-dimethyl-1-(4-methyl-1,3-oxazol-2-yl)methanamine;3-formyl-N-[3-[(4-methoxyphenyl)sulfinyl-(2-methylpropyl)amino]propyl]benzamide;toluene.
| Compound Name | N,N-dimethyl-1-(4-methyl-1,3-oxazol-2-yl)methanamine;3-formyl-N-[3-[(4-methoxyphenyl)sulfinyl-(2-methylpropyl)amino]propyl]benzamide;toluene |
|---|---|
| PubChem CID | 143922005 |
| Molecular Formula | C36H48N4O5S |
| Molecular Weight | 648.87 g/mol |
| Exact Mass | 648.33 |
| IUPAC Name | N,N-dimethyl-1-(4-methyl-1,3-oxazol-2-yl)methanamine;3-formyl-N-[3-[(4-methoxyphenyl)sulfinyl-(2-methylpropyl)amino]propyl]benzamide;toluene |
| SMILES | COc1ccc(S(=O)N(CCCNC(=O)c2cccc(C=O)c2)CC(C)C)cc1.Cc1ccccc1.Cc1coc(CN(C)C)n1 |
| InChI | InChI=1S/C22H28N2O4S.C7H12N2O.C7H8/c1-17(2)15-24(29(27)21-10-8-20(28-3)9-11-21)13-5-12-23-22(26)19-7-4-6-18(14-19)16-25;1-6-5-10-7(8-6)4-9(2)3;1-7-5-3-2-4-6-7/h4,6-11,14,16-17H,5,12-13,15H2,1-3H3,(H,23,26);5H,4H2,1-3H3;2-6H,1H3 |
| InChIKey | ZHHDLVXFMMECRE-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.87 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|