C21H34N2O6S — CID 142959582
[(3R,4R)-4-(2-hydroxyethyl)oxolan-3-yl] N-[3-[(4-methoxyphenyl)sulfinyl-(2-methylpropyl)amino]propyl]carbamate (PubChem CID 142959582) has the molecular formula C21H34N2O6S and a molecular weight of 442.58 g/mol. Its IUPAC name is [(3R,4R)-4-(2-hydroxyethyl)oxolan-3-yl] N-[3-[(4-methoxyphenyl)sulfinyl-(2-methylpropyl)amino]propyl]carbamate.
| Compound Name | [(3R,4R)-4-(2-hydroxyethyl)oxolan-3-yl] N-[3-[(4-methoxyphenyl)sulfinyl-(2-methylpropyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 142959582 |
| Molecular Formula | C21H34N2O6S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [(3R,4R)-4-(2-hydroxyethyl)oxolan-3-yl] N-[3-[(4-methoxyphenyl)sulfinyl-(2-methylpropyl)amino]propyl]carbamate |
| SMILES | COc1ccc(S(=O)N(CCCNC(=O)O[C@H]2COC[C@H]2CCO)CC(C)C)cc1 |
| InChI | InChI=1S/C21H34N2O6S/c1-16(2)13-23(30(26)19-7-5-18(27-3)6-8-19)11-4-10-22-21(25)29-20-15-28-14-17(20)9-12-24/h5-8,16-17,20,24H,4,9-15H2,1-3H3,(H,22,25)/t17-,20+,30?/m1/s1 |
| InChIKey | FKHFHLWONVCMMY-VUJRGGNTSA-N |
| XLogP | 2.19 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|