C27H41N3O4S — CID 143073150
acetylene;[(2R)-4-hydroxybutan-2-yl] N-[3-[(4-aminophenyl)sulfinyl-(2-methylpropyl)amino]propyl]carbamate;toluene (PubChem CID 143073150) has the molecular formula C27H41N3O4S and a molecular weight of 503.71 g/mol. Its IUPAC name is acetylene;[(2R)-4-hydroxybutan-2-yl] N-[3-[(4-aminophenyl)sulfinyl-(2-methylpropyl)amino]propyl]carbamate;toluene.
| Compound Name | acetylene;[(2R)-4-hydroxybutan-2-yl] N-[3-[(4-aminophenyl)sulfinyl-(2-methylpropyl)amino]propyl]carbamate;toluene |
|---|---|
| PubChem CID | 143073150 |
| Molecular Formula | C27H41N3O4S |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | acetylene;[(2R)-4-hydroxybutan-2-yl] N-[3-[(4-aminophenyl)sulfinyl-(2-methylpropyl)amino]propyl]carbamate;toluene |
| SMILES | C#C.CC(C)CN(CCCNC(=O)O[C@H](C)CCO)S(=O)c1ccc(N)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C18H31N3O4S.C7H8.C2H2/c1-14(2)13-21(26(24)17-7-5-16(19)6-8-17)11-4-10-20-18(23)25-15(3)9-12-22;1-7-5-3-2-4-6-7;1-2/h5-8,14-15,22H,4,9-13,19H2,1-3H3,(H,20,23);2-6H,1H3;1-2H/t15-,26?;;/m1../s1 |
| InChIKey | FZVUIIUHBWCFAQ-LMWNLHBOSA-N |
| XLogP | 4.38 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|