C15H22N2O6 — CID 139397465
3-(4-hydroxybutan-2-yloxycarbonylamino)propyl 5-amino-2-hydroxybenzoate (PubChem CID 139397465) has the molecular formula C15H22N2O6 and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-(4-hydroxybutan-2-yloxycarbonylamino)propyl 5-amino-2-hydroxybenzoate.
| Compound Name | 3-(4-hydroxybutan-2-yloxycarbonylamino)propyl 5-amino-2-hydroxybenzoate |
|---|---|
| PubChem CID | 139397465 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 3-(4-hydroxybutan-2-yloxycarbonylamino)propyl 5-amino-2-hydroxybenzoate |
| SMILES | CC(CCO)OC(=O)NCCCOC(=O)c1cc(N)ccc1O |
| InChI | InChI=1S/C15H22N2O6/c1-10(5-7-18)23-15(21)17-6-2-8-22-14(20)12-9-11(16)3-4-13(12)19/h3-4,9-10,18-19H,2,5-8,16H2,1H3,(H,17,21) |
| InChIKey | MZJKOIOVNYRDCA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|