C26H40N2O4S — CID 143072901
tert-butyl N-[3-[(3-hydroxy-4-methoxyphenyl)sulfanyl-(2-methylpropyl)amino]propyl]carbamate;toluene (PubChem CID 143072901) has the molecular formula C26H40N2O4S and a molecular weight of 476.68 g/mol. Its IUPAC name is tert-butyl N-[3-[(3-hydroxy-4-methoxyphenyl)sulfanyl-(2-methylpropyl)amino]propyl]carbamate;toluene.
| Compound Name | tert-butyl N-[3-[(3-hydroxy-4-methoxyphenyl)sulfanyl-(2-methylpropyl)amino]propyl]carbamate;toluene |
|---|---|
| PubChem CID | 143072901 |
| Molecular Formula | C26H40N2O4S |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | tert-butyl N-[3-[(3-hydroxy-4-methoxyphenyl)sulfanyl-(2-methylpropyl)amino]propyl]carbamate;toluene |
| SMILES | COc1ccc(SN(CCCNC(=O)OC(C)(C)C)CC(C)C)cc1O.Cc1ccccc1 |
| InChI | InChI=1S/C19H32N2O4S.C7H8/c1-14(2)13-21(11-7-10-20-18(23)25-19(3,4)5)26-15-8-9-17(24-6)16(22)12-15;1-7-5-3-2-4-6-7/h8-9,12,14,22H,7,10-11,13H2,1-6H3,(H,20,23);2-6H,1H3 |
| InChIKey | COKCBCLGKZNVNW-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|