C29H40F2N4O2S2 — CID 142349949
tert-butyl N-[3-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfanyl-(2-methylpropyl)amino]propyl]carbamate;1,3-difluoro-5-methylbenzene (PubChem CID 142349949) has the molecular formula C29H40F2N4O2S2 and a molecular weight of 578.80 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfanyl-(2-methylpropyl)amino]propyl]carbamate;1,3-difluoro-5-methylbenzene.
| Compound Name | tert-butyl N-[3-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfanyl-(2-methylpropyl)amino]propyl]carbamate;1,3-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 142349949 |
| Molecular Formula | C29H40F2N4O2S2 |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | tert-butyl N-[3-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfanyl-(2-methylpropyl)amino]propyl]carbamate;1,3-difluoro-5-methylbenzene |
| SMILES | CC(C)CN(CCCNC(=O)OC(C)(C)C)Sc1ccc2nc(NC3CC3)sc2c1.Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C22H34N4O2S2.C7H6F2/c1-15(2)14-26(12-6-11-23-21(27)28-22(3,4)5)30-17-9-10-18-19(13-17)29-20(25-18)24-16-7-8-16;1-5-2-6(8)4-7(9)3-5/h9-10,13,15-16H,6-8,11-12,14H2,1-5H3,(H,23,27)(H,24,25);2-4H,1H3 |
| InChIKey | HHQSRGZMMLIPBJ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|