C19H28N4S2 — CID 144962250
N'-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfanyl]-N-methyl-N'-[(1-methylcyclopropyl)methyl]propane-1,3-diamine (PubChem CID 144962250) has the molecular formula C19H28N4S2 and a molecular weight of 376.60 g/mol. Its IUPAC name is N'-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfanyl]-N-methyl-N'-[(1-methylcyclopropyl)methyl]propane-1,3-diamine.
| Compound Name | N'-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfanyl]-N-methyl-N'-[(1-methylcyclopropyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 144962250 |
| Molecular Formula | C19H28N4S2 |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N'-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfanyl]-N-methyl-N'-[(1-methylcyclopropyl)methyl]propane-1,3-diamine |
| SMILES | CNCCCN(CC1(C)CC1)Sc1ccc2nc(NC3CC3)sc2c1 |
| InChI | InChI=1S/C19H28N4S2/c1-19(8-9-19)13-23(11-3-10-20-2)25-15-6-7-16-17(12-15)24-18(22-16)21-14-4-5-14/h6-7,12,14,20H,3-5,8-11,13H2,1-2H3,(H,21,22) |
| InChIKey | RBFQUZMKZQJFFX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|