C27H36N4O7S2 — CID 123302783
2,4,8-trioxatricyclo[4.4.1.03,9]undecan-11-yl N-[3-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfonyl-[(1-methylcyclopropyl)methyl]amino]propyl]carbamate (PubChem CID 123302783) has the molecular formula C27H36N4O7S2 and a molecular weight of 592.74 g/mol. Its IUPAC name is 2,4,8-trioxatricyclo[4.4.1.03,9]undecan-11-yl N-[3-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfonyl-[(1-methylcyclopropyl)methyl]amino]propyl]carbamate.
| Compound Name | 2,4,8-trioxatricyclo[4.4.1.03,9]undecan-11-yl N-[3-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfonyl-[(1-methylcyclopropyl)methyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 123302783 |
| Molecular Formula | C27H36N4O7S2 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | 2,4,8-trioxatricyclo[4.4.1.03,9]undecan-11-yl N-[3-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfonyl-[(1-methylcyclopropyl)methyl]amino]propyl]carbamate |
| SMILES | CC1(CN(CCCNC(=O)OC2C3COC4CC2OC4OC3)S(=O)(=O)c2ccc3nc(NC4CC4)sc3c2)CC1 |
| InChI | InChI=1S/C27H36N4O7S2/c1-27(7-8-27)15-31(40(33,34)18-5-6-19-22(11-18)39-25(30-19)29-17-3-4-17)10-2-9-28-26(32)38-23-16-13-35-21-12-20(23)37-24(21)36-14-16/h5-6,11,16-17,20-21,23-24H,2-4,7-10,12-15H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | GAKQEDGXJMAKOQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|