C19H26N4OS2 — CID 144962193
N-[3-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfanyl-[(1-methylcyclopropyl)methyl]amino]propyl]formamide (PubChem CID 144962193) has the molecular formula C19H26N4OS2 and a molecular weight of 390.58 g/mol. Its IUPAC name is N-[3-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfanyl-[(1-methylcyclopropyl)methyl]amino]propyl]formamide.
| Compound Name | N-[3-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfanyl-[(1-methylcyclopropyl)methyl]amino]propyl]formamide |
|---|---|
| PubChem CID | 144962193 |
| Molecular Formula | C19H26N4OS2 |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-[3-[[2-(cyclopropylamino)-1,3-benzothiazol-6-yl]sulfanyl-[(1-methylcyclopropyl)methyl]amino]propyl]formamide |
| SMILES | CC1(CN(CCCNC=O)Sc2ccc3nc(NC4CC4)sc3c2)CC1 |
| InChI | InChI=1S/C19H26N4OS2/c1-19(7-8-19)12-23(10-2-9-20-13-24)26-15-5-6-16-17(11-15)25-18(22-16)21-14-3-4-14/h5-6,11,13-14H,2-4,7-10,12H2,1H3,(H,20,24)(H,21,22) |
| InChIKey | CXCJXACXVJYRIN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|