C22H30N2O4S — CID 71146142
benzyl N-[3-[benzenesulfonyl(3-methylbutyl)amino]propyl]carbamate (PubChem CID 71146142) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is benzyl N-[3-[benzenesulfonyl(3-methylbutyl)amino]propyl]carbamate.
| Compound Name | benzyl N-[3-[benzenesulfonyl(3-methylbutyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 71146142 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | benzyl N-[3-[benzenesulfonyl(3-methylbutyl)amino]propyl]carbamate |
| SMILES | CC(C)CCN(CCCNC(=O)OCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H30N2O4S/c1-19(2)14-17-24(29(26,27)21-12-7-4-8-13-21)16-9-15-23-22(25)28-18-20-10-5-3-6-11-20/h3-8,10-13,19H,9,14-18H2,1-2H3,(H,23,25) |
| InChIKey | CFIVXHIETDSPNP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|