C16H25NO3 — CID 145481945
N-(4-methoxyphenyl)-N-(2-methylpropyl)formamide;3-methyloxetane (PubChem CID 145481945) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-(2-methylpropyl)formamide;3-methyloxetane.
| Compound Name | N-(4-methoxyphenyl)-N-(2-methylpropyl)formamide;3-methyloxetane |
|---|---|
| PubChem CID | 145481945 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | N-(4-methoxyphenyl)-N-(2-methylpropyl)formamide;3-methyloxetane |
| SMILES | CC1COC1.COc1ccc(N(C=O)CC(C)C)cc1 |
| InChI | InChI=1S/C12H17NO2.C4H8O/c1-10(2)8-13(9-14)11-4-6-12(15-3)7-5-11;1-4-2-5-3-4/h4-7,9-10H,8H2,1-3H3;4H,2-3H2,1H3 |
| InChIKey | RULOMVAQRWOXIX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|