C18H27NO2 — CID 168868561
N-(4-methoxyphenyl)-N-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]formamide (PubChem CID 168868561) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]formamide.
| Compound Name | N-(4-methoxyphenyl)-N-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]formamide |
|---|---|
| PubChem CID | 168868561 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-(4-methoxyphenyl)-N-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]formamide |
| SMILES | COc1ccc(N(C=O)[C@@H]2C[C@H](C)CC[C@H]2C(C)C)cc1 |
| InChI | InChI=1S/C18H27NO2/c1-13(2)17-10-5-14(3)11-18(17)19(12-20)15-6-8-16(21-4)9-7-15/h6-9,12-14,17-18H,5,10-11H2,1-4H3/t14-,17+,18-/m1/s1 |
| InChIKey | GJONLJRGZIEIBY-FHLIZLRMSA-N |
| XLogP | 4.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|