C25H42N2 — CID 22480097
N,N-bis(5-methyl-2-propan-2-ylcyclohexyl)pyridin-4-amine (PubChem CID 22480097) has the molecular formula C25H42N2 and a molecular weight of 370.63 g/mol. Its IUPAC name is N,N-bis(5-methyl-2-propan-2-ylcyclohexyl)pyridin-4-amine.
| Compound Name | N,N-bis(5-methyl-2-propan-2-ylcyclohexyl)pyridin-4-amine |
|---|---|
| PubChem CID | 22480097 |
| Molecular Formula | C25H42N2 |
| Molecular Weight | 370.63 g/mol |
| Exact Mass | 370.33 |
| IUPAC Name | N,N-bis(5-methyl-2-propan-2-ylcyclohexyl)pyridin-4-amine |
| SMILES | CC1CCC(C(C)C)C(N(c2ccncc2)C2CC(C)CCC2C(C)C)C1 |
| InChI | InChI=1S/C25H42N2/c1-17(2)22-9-7-19(5)15-24(22)27(21-11-13-26-14-12-21)25-16-20(6)8-10-23(25)18(3)4/h11-14,17-20,22-25H,7-10,15-16H2,1-6H3 |
| InChIKey | KJVJOSCMUTVLEG-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.63 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |