C22H17FN2O3 — CID 143784173
2-fluoro-4-[N'-[4-(2-methylphenyl)benzoyl]carbamimidoyl]benzoic acid (PubChem CID 143784173) has the molecular formula C22H17FN2O3 and a molecular weight of 376.39 g/mol. Its IUPAC name is 2-fluoro-4-[N'-[4-(2-methylphenyl)benzoyl]carbamimidoyl]benzoic acid.
| Compound Name | 2-fluoro-4-[N'-[4-(2-methylphenyl)benzoyl]carbamimidoyl]benzoic acid |
|---|---|
| PubChem CID | 143784173 |
| Molecular Formula | C22H17FN2O3 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-fluoro-4-[N'-[4-(2-methylphenyl)benzoyl]carbamimidoyl]benzoic acid |
| SMILES | Cc1ccccc1-c1ccc(C(=O)/N=C(\N)c2ccc(C(=O)O)c(F)c2)cc1 |
| InChI | InChI=1S/C22H17FN2O3/c1-13-4-2-3-5-17(13)14-6-8-15(9-7-14)21(26)25-20(24)16-10-11-18(22(27)28)19(23)12-16/h2-12H,1H3,(H,27,28)(H2,24,25,26) |
| InChIKey | MXZXVMFQVHJBGU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|