C22H26N8O2 — CID 143784570
(Z)-4-[[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-3-ylmethylamino)-3-pyridinyl]-methylamino]-2-methylidenebut-3-enoic acid (PubChem CID 143784570) has the molecular formula C22H26N8O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is (Z)-4-[[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-3-ylmethylamino)-3-pyridinyl]-methylamino]-2-methylidenebut-3-enoic acid.
| Compound Name | (Z)-4-[[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-3-ylmethylamino)-3-pyridinyl]-methylamino]-2-methylidenebut-3-enoic acid |
|---|---|
| PubChem CID | 143784570 |
| Molecular Formula | C22H26N8O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (Z)-4-[[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-3-ylmethylamino)-3-pyridinyl]-methylamino]-2-methylidenebut-3-enoic acid |
| SMILES | C=C(/C=C\N(C)c1cnc(Nc2cnc(C#N)cn2)cc1NCC1CCCNC1)C(=O)O |
| InChI | InChI=1S/C22H26N8O2/c1-15(22(31)32)5-7-30(2)19-13-28-20(29-21-14-25-17(9-23)12-27-21)8-18(19)26-11-16-4-3-6-24-10-16/h5,7-8,12-14,16,24H,1,3-4,6,10-11H2,2H3,(H,31,32)(H2,26,27,28,29)/b7-5- |
| InChIKey | ICYJLWPEOCENNG-ALCCZGGFSA-N |
| XLogP | 2.49 |
| TPSA | 139.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|