C19H24NO2 — CID 143786080
CID 143786080 (PubChem CID 143786080) has the molecular formula C19H24NO2 and a molecular weight of 298.41 g/mol.
| Compound Name | CID 143786080 |
|---|---|
| PubChem CID | 143786080 |
| Molecular Formula | C19H24NO2 |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | — |
| SMILES | CC(CN1CCCC1)[C@H](O)c1ccc2c(c1)OCCC1=C[C]12 |
| InChI | InChI=1S/C19H24NO2/c1-13(12-20-7-2-3-8-20)19(21)15-4-5-16-17-10-14(17)6-9-22-18(16)11-15/h4-5,10-11,13,19,21H,2-3,6-9,12H2,1H3/t13?,19-/m0/s1 |
| InChIKey | LSEYMPDMKUXUDP-YFKXAPIDSA-N |
| XLogP | 3.10 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |