C16H26F2N2 — CID 143787887
(2Z,5E)-1-(1-ethylpiperidin-4-yl)-3,6-difluoro-2-methylocta-2,5-dien-1-imine (PubChem CID 143787887) has the molecular formula C16H26F2N2 and a molecular weight of 284.39 g/mol. Its IUPAC name is (2Z,5E)-1-(1-ethylpiperidin-4-yl)-3,6-difluoro-2-methylocta-2,5-dien-1-imine.
| Compound Name | (2Z,5E)-1-(1-ethylpiperidin-4-yl)-3,6-difluoro-2-methylocta-2,5-dien-1-imine |
|---|---|
| PubChem CID | 143787887 |
| Molecular Formula | C16H26F2N2 |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (2Z,5E)-1-(1-ethylpiperidin-4-yl)-3,6-difluoro-2-methylocta-2,5-dien-1-imine |
| SMILES | [H]/N=C(C(\C)=C(/F)C/C=C(/F)CC)/C1CCN(CC)CC1 |
| InChI | InChI=1S/C16H26F2N2/c1-4-14(17)6-7-15(18)12(3)16(19)13-8-10-20(5-2)11-9-13/h6,13,19H,4-5,7-11H2,1-3H3/b14-6+,15-12-,19-16+ |
| InChIKey | JOUKSYLCTHQRPK-JUERWAEWSA-N |
| XLogP | 4.64 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|