C14H23F2N3 — CID 142021201
(Z)-6,6-difluoro-8-(1-methylpiperidin-4-yl)oct-3-ene-2,5-diimine (PubChem CID 142021201) has the molecular formula C14H23F2N3 and a molecular weight of 271.35 g/mol. Its IUPAC name is (Z)-6,6-difluoro-8-(1-methylpiperidin-4-yl)oct-3-ene-2,5-diimine.
| Compound Name | (Z)-6,6-difluoro-8-(1-methylpiperidin-4-yl)oct-3-ene-2,5-diimine |
|---|---|
| PubChem CID | 142021201 |
| Molecular Formula | C14H23F2N3 |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (Z)-6,6-difluoro-8-(1-methylpiperidin-4-yl)oct-3-ene-2,5-diimine |
| SMILES | [H]/N=C(/C=C\C(C)=N\[H])C(F)(F)CCC1CCN(C)CC1 |
| InChI | InChI=1S/C14H23F2N3/c1-11(17)3-4-13(18)14(15,16)8-5-12-6-9-19(2)10-7-12/h3-4,12,17-18H,5-10H2,1-2H3/b4-3-,17-11+,18-13- |
| InChIKey | RIYTXCSXCDJYKG-VCFUZQJISA-N |
| XLogP | 3.36 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|