C21H23ClF4O — CID 143788501
2-[4-(chloromethyl)-2-(2,2-dimethylpentyl)phenyl]-1-fluoro-4-(trifluoromethoxy)benzene (PubChem CID 143788501) has the molecular formula C21H23ClF4O and a molecular weight of 402.86 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-2-(2,2-dimethylpentyl)phenyl]-1-fluoro-4-(trifluoromethoxy)benzene.
| Compound Name | 2-[4-(chloromethyl)-2-(2,2-dimethylpentyl)phenyl]-1-fluoro-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 143788501 |
| Molecular Formula | C21H23ClF4O |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[4-(chloromethyl)-2-(2,2-dimethylpentyl)phenyl]-1-fluoro-4-(trifluoromethoxy)benzene |
| SMILES | CCCC(C)(C)Cc1cc(CCl)ccc1-c1cc(OC(F)(F)F)ccc1F |
| InChI | InChI=1S/C21H23ClF4O/c1-4-9-20(2,3)12-15-10-14(13-22)5-7-17(15)18-11-16(6-8-19(18)23)27-21(24,25)26/h5-8,10-11H,4,9,12-13H2,1-3H3 |
| InChIKey | ZEHDVUMKHZXLBH-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|