C20H23FO2 — CID 143788779
[5-ethyl-2-(2-fluoro-5-methoxyphenyl)phenyl]-(1-methylcyclopropyl)methanol (PubChem CID 143788779) has the molecular formula C20H23FO2 and a molecular weight of 314.40 g/mol. Its IUPAC name is [5-ethyl-2-(2-fluoro-5-methoxyphenyl)phenyl]-(1-methylcyclopropyl)methanol.
| Compound Name | [5-ethyl-2-(2-fluoro-5-methoxyphenyl)phenyl]-(1-methylcyclopropyl)methanol |
|---|---|
| PubChem CID | 143788779 |
| Molecular Formula | C20H23FO2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | [5-ethyl-2-(2-fluoro-5-methoxyphenyl)phenyl]-(1-methylcyclopropyl)methanol |
| SMILES | CCc1ccc(-c2cc(OC)ccc2F)c(C(O)C2(C)CC2)c1 |
| InChI | InChI=1S/C20H23FO2/c1-4-13-5-7-15(16-12-14(23-3)6-8-18(16)21)17(11-13)19(22)20(2)9-10-20/h5-8,11-12,19,22H,4,9-10H2,1-3H3 |
| InChIKey | FUHOFZHDUPGDTN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |