C20H27FO2 — CID 143789047
ethane;1-[5-ethyl-2-(2-fluoro-5-methoxyphenyl)phenyl]propan-1-ol (PubChem CID 143789047) has the molecular formula C20H27FO2 and a molecular weight of 318.43 g/mol. Its IUPAC name is ethane;1-[5-ethyl-2-(2-fluoro-5-methoxyphenyl)phenyl]propan-1-ol.
| Compound Name | ethane;1-[5-ethyl-2-(2-fluoro-5-methoxyphenyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 143789047 |
| Molecular Formula | C20H27FO2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | ethane;1-[5-ethyl-2-(2-fluoro-5-methoxyphenyl)phenyl]propan-1-ol |
| SMILES | CC.CCc1ccc(-c2cc(OC)ccc2F)c(C(O)CC)c1 |
| InChI | InChI=1S/C18H21FO2.C2H6/c1-4-12-6-8-14(16(10-12)18(20)5-2)15-11-13(21-3)7-9-17(15)19;1-2/h6-11,18,20H,4-5H2,1-3H3;1-2H3 |
| InChIKey | BEZNZQDUWQJNTI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |