C26H27NO3 — CID 143789659
(5S)-5,24,24-trimethyl-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,18,20-hexaen-22-one (PubChem CID 143789659) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is (5S)-5,24,24-trimethyl-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,18,20-hexaen-22-one.
| Compound Name | (5S)-5,24,24-trimethyl-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,18,20-hexaen-22-one |
|---|---|
| PubChem CID | 143789659 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (5S)-5,24,24-trimethyl-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,18,20-hexaen-22-one |
| SMILES | CC1(C)OC23CCC4C(=CCC5Cc6c([nH]c7ccccc67)[C@@]54C)C2=CC(=O)C1O3 |
| InChI | InChI=1S/C26H27NO3/c1-24(2)23-21(28)13-19-16-9-8-14-12-17-15-6-4-5-7-20(15)27-22(17)25(14,3)18(16)10-11-26(19,29-23)30-24/h4-7,9,13-14,18,23,27H,8,10-12H2,1-3H3/t14?,18?,23?,25-,26?/m0/s1 |
| InChIKey | HDFCFPLEZMZWBC-QYRXKJEUSA-N |
| XLogP | 4.74 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |