C27H31NO4 — CID 143789778
(1S,5S,18S)-18-hydroxy-4,5,24,24-tetramethyl-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,20-pentaen-22-one (PubChem CID 143789778) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is (1S,5S,18S)-18-hydroxy-4,5,24,24-tetramethyl-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,20-pentaen-22-one.
| Compound Name | (1S,5S,18S)-18-hydroxy-4,5,24,24-tetramethyl-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,20-pentaen-22-one |
|---|---|
| PubChem CID | 143789778 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (1S,5S,18S)-18-hydroxy-4,5,24,24-tetramethyl-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,20-pentaen-22-one |
| SMILES | CC1(C)O[C@@]23CCC4(C)C(C2=CC(=O)C1O3)[C@@H](O)CC1Cc2c([nH]c3ccccc23)[C@@]14C |
| InChI | InChI=1S/C27H31NO4/c1-24(2)23-20(30)13-17-21-19(29)12-14-11-16-15-7-5-6-8-18(15)28-22(16)26(14,4)25(21,3)9-10-27(17,31-23)32-24/h5-8,13-14,19,21,23,28-29H,9-12H2,1-4H3/t14?,19-,21?,23?,25?,26+,27-/m0/s1 |
| InChIKey | UIHYZKAFFMTIFE-YLPBRDEESA-N |
| XLogP | 4.18 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |