About 4-(iodomethyl)-1H-indole
4-(iodomethyl)-1H-indole (PubChem CID 143791617) has the molecular formula C9H8IN
and a molecular weight of 257.07 g/mol. Its IUPAC name is 4-(iodomethyl)-1H-indole.
Molecular Properties
| Compound Name | 4-(iodomethyl)-1H-indole |
| PubChem CID | 143791617 |
| Molecular Formula | C9H8IN |
| Molecular Weight | 257.07 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | 4-(iodomethyl)-1H-indole |
| SMILES | ICc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C9H8IN/c10-6-7-2-1-3-9-8(7)4-5-11-9/h1-5,11H,6H2 |
| InChIKey | CMGCNHYLWHLESL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.07 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(iodomethyl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(iodomethyl)-1H-indole?
The IUPAC name of 4-(iodomethyl)-1H-indole (CID 143791617) is 4-(iodomethyl)-1H-indole.
What is the SMILES notation for 4-(iodomethyl)-1H-indole?
The canonical SMILES for 4-(iodomethyl)-1H-indole is ICc1cccc2[nH]ccc12.
What is the InChIKey of 4-(iodomethyl)-1H-indole?
The InChIKey is CMGCNHYLWHLESL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8IN/c10-6-7-2-1-3-9-8(7)4-5-11-9/h1-5,11H,6H2.
What are the key properties of 4-(iodomethyl)-1H-indole?
4-(iodomethyl)-1H-indole has a molecular weight of 257.07 g/mol, XLogP of 3.10, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(iodomethyl)-1H-indole is sourced from PubChem (CID 143791617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).