About ethane;1H-indol-4-ylmethanamine
ethane;1H-indol-4-ylmethanamine (PubChem CID 144540106) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is ethane;1H-indol-4-ylmethanamine.
Molecular Properties
| Compound Name | ethane;1H-indol-4-ylmethanamine |
| PubChem CID | 144540106 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | ethane;1H-indol-4-ylmethanamine |
| SMILES | CC.CC.NCc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C9H10N2.2C2H6/c10-6-7-2-1-3-9-8(7)4-5-11-9;2*1-2/h1-5,11H,6,10H2;2*1-2H3 |
| InChIKey | GDIKLPHKHNENQX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1H-indol-4-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1H-indol-4-ylmethanamine?
The IUPAC name of ethane;1H-indol-4-ylmethanamine (CID 144540106) is ethane;1H-indol-4-ylmethanamine.
What is the SMILES notation for ethane;1H-indol-4-ylmethanamine?
The canonical SMILES for ethane;1H-indol-4-ylmethanamine is CC.CC.NCc1cccc2[nH]ccc12.
What is the InChIKey of ethane;1H-indol-4-ylmethanamine?
The InChIKey is GDIKLPHKHNENQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.2C2H6/c10-6-7-2-1-3-9-8(7)4-5-11-9;2*1-2/h1-5,11H,6,10H2;2*1-2H3.
What are the key properties of ethane;1H-indol-4-ylmethanamine?
ethane;1H-indol-4-ylmethanamine has a molecular weight of 206.33 g/mol, XLogP of 3.68, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1H-indol-4-ylmethanamine is sourced from PubChem (CID 144540106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).