About 1H-indol-4-amine;hydrochloride
1H-indol-4-amine;hydrochloride (PubChem CID 22461572) has the molecular formula C8H9ClN2
and a molecular weight of 168.63 g/mol. Its IUPAC name is 1H-indol-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 1H-indol-4-amine;hydrochloride |
| PubChem CID | 22461572 |
| Molecular Formula | C8H9ClN2 |
| Molecular Weight | 168.63 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 1H-indol-4-amine;hydrochloride |
| SMILES | Cl.Nc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C8H8N2.ClH/c9-7-2-1-3-8-6(7)4-5-10-8;/h1-5,10H,9H2;1H |
| InChIKey | RRDMEBTXVSZFJA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.63 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1H-indol-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-4-amine;hydrochloride?
The IUPAC name of 1H-indol-4-amine;hydrochloride (CID 22461572) is 1H-indol-4-amine;hydrochloride.
What is the SMILES notation for 1H-indol-4-amine;hydrochloride?
The canonical SMILES for 1H-indol-4-amine;hydrochloride is Cl.Nc1cccc2[nH]ccc12.
What is the InChIKey of 1H-indol-4-amine;hydrochloride?
The InChIKey is RRDMEBTXVSZFJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.ClH/c9-7-2-1-3-8-6(7)4-5-10-8;/h1-5,10H,9H2;1H.
What are the key properties of 1H-indol-4-amine;hydrochloride?
1H-indol-4-amine;hydrochloride has a molecular weight of 168.63 g/mol, XLogP of 2.17, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-4-amine;hydrochloride is sourced from PubChem (CID 22461572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).