C18H21F2NO — CID 143792344
(2E,4E)-2-ethenyl-5-fluoro-1-[4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidin-4-yl]penta-2,4-dien-1-one (PubChem CID 143792344) has the molecular formula C18H21F2NO and a molecular weight of 305.37 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-5-fluoro-1-[4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidin-4-yl]penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-2-ethenyl-5-fluoro-1-[4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidin-4-yl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 143792344 |
| Molecular Formula | C18H21F2NO |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (2E,4E)-2-ethenyl-5-fluoro-1-[4-(4-fluorocyclohexa-1,5-dien-1-yl)piperidin-4-yl]penta-2,4-dien-1-one |
| SMILES | C=C/C(=C\C=C\F)C(=O)C1(C2=CCC(F)C=C2)CCNCC1 |
| InChI | InChI=1S/C18H21F2NO/c1-2-14(4-3-11-19)17(22)18(9-12-21-13-10-18)15-5-7-16(20)8-6-15/h2-7,11,16,21H,1,8-10,12-13H2/b11-3+,14-4+ |
| InChIKey | GBRFVZQNXPXGRW-RGMFKVBISA-N |
| XLogP | 3.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|