C13H18FNO — CID 143923274
(3Z,5E)-5-fluoro-2-methylidene-1-piperidin-4-ylhepta-3,5-dien-1-one (PubChem CID 143923274) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is (3Z,5E)-5-fluoro-2-methylidene-1-piperidin-4-ylhepta-3,5-dien-1-one.
| Compound Name | (3Z,5E)-5-fluoro-2-methylidene-1-piperidin-4-ylhepta-3,5-dien-1-one |
|---|---|
| PubChem CID | 143923274 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (3Z,5E)-5-fluoro-2-methylidene-1-piperidin-4-ylhepta-3,5-dien-1-one |
| SMILES | C=C(/C=C\C(F)=C/C)C(=O)C1CCNCC1 |
| InChI | InChI=1S/C13H18FNO/c1-3-12(14)5-4-10(2)13(16)11-6-8-15-9-7-11/h3-5,11,15H,2,6-9H2,1H3/b5-4-,12-3+ |
| InChIKey | FVCBBANPDVDTSS-YPBGMLOESA-N |
| XLogP | 2.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|