C13H22FNO — CID 153392420
(Z,5E)-1-amino-3-ethyl-5-ethylidene-8-fluoronon-6-en-4-one (PubChem CID 153392420) has the molecular formula C13H22FNO and a molecular weight of 227.32 g/mol. Its IUPAC name is (Z,5E)-1-amino-3-ethyl-5-ethylidene-8-fluoronon-6-en-4-one.
| Compound Name | (Z,5E)-1-amino-3-ethyl-5-ethylidene-8-fluoronon-6-en-4-one |
|---|---|
| PubChem CID | 153392420 |
| Molecular Formula | C13H22FNO |
| Molecular Weight | 227.32 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (Z,5E)-1-amino-3-ethyl-5-ethylidene-8-fluoronon-6-en-4-one |
| SMILES | C/C=C(\C=C/C(C)F)C(=O)C(CC)CCN |
| InChI | InChI=1S/C13H22FNO/c1-4-11(7-6-10(3)14)13(16)12(5-2)8-9-15/h4,6-7,10,12H,5,8-9,15H2,1-3H3/b7-6-,11-4+ |
| InChIKey | GUFOTSMKRNXVHA-BJNIYONUSA-N |
| XLogP | 2.79 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|