About 1-(5-amino-6-methylcyclohexa-1,3-dien-1-yl)ethanone
1-(5-amino-6-methylcyclohexa-1,3-dien-1-yl)ethanone (PubChem CID 142139408) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-(5-amino-6-methylcyclohexa-1,3-dien-1-yl)ethanone.
Analyze 1-(5-amino-6-methylcyclohexa-1,3-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-6-methylcyclohexa-1,3-dien-1-yl)ethanone?
The IUPAC name of 1-(5-amino-6-methylcyclohexa-1,3-dien-1-yl)ethanone (CID 142139408) is 1-(5-amino-6-methylcyclohexa-1,3-dien-1-yl)ethanone.
What is the SMILES notation for 1-(5-amino-6-methylcyclohexa-1,3-dien-1-yl)ethanone?
The canonical SMILES for 1-(5-amino-6-methylcyclohexa-1,3-dien-1-yl)ethanone is CC(=O)C1=CC=CC(N)C1C.
What is the InChIKey of 1-(5-amino-6-methylcyclohexa-1,3-dien-1-yl)ethanone?
The InChIKey is QXKZAEVEOMJZAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-6-8(7(2)11)4-3-5-9(6)10/h3-6,9H,10H2,1-2H3.
What are the key properties of 1-(5-amino-6-methylcyclohexa-1,3-dien-1-yl)ethanone?
1-(5-amino-6-methylcyclohexa-1,3-dien-1-yl)ethanone has a molecular weight of 151.21 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-6-methylcyclohexa-1,3-dien-1-yl)ethanone is sourced from PubChem (CID 142139408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).