C13H18FNO — CID 123695996
3-(4-fluoro-2-methylhepta-3,5-dienylidene)piperidin-4-one (PubChem CID 123695996) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is 3-(4-fluoro-2-methylhepta-3,5-dienylidene)piperidin-4-one.
| Compound Name | 3-(4-fluoro-2-methylhepta-3,5-dienylidene)piperidin-4-one |
|---|---|
| PubChem CID | 123695996 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-(4-fluoro-2-methylhepta-3,5-dienylidene)piperidin-4-one |
| SMILES | CC=CC(F)=CC(C)C=C1CNCCC1=O |
| InChI | InChI=1S/C13H18FNO/c1-3-4-12(14)8-10(2)7-11-9-15-6-5-13(11)16/h3-4,7-8,10,15H,5-6,9H2,1-2H3 |
| InChIKey | FNUOCAMGBJIZQN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|