C11H12FNO — CID 143751641
(4aZ,10E)-5-fluoro-2,3,6,9-tetrahydro-1H-cycloocta[b]pyridin-4-one (PubChem CID 143751641) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is (4aZ,10E)-5-fluoro-2,3,6,9-tetrahydro-1H-cycloocta[b]pyridin-4-one.
| Compound Name | (4aZ,10E)-5-fluoro-2,3,6,9-tetrahydro-1H-cycloocta[b]pyridin-4-one |
|---|---|
| PubChem CID | 143751641 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (4aZ,10E)-5-fluoro-2,3,6,9-tetrahydro-1H-cycloocta[b]pyridin-4-one |
| SMILES | O=C1CCN/C2=C/CC=CC/C(F)=C\12 |
| InChI | InChI=1S/C11H12FNO/c12-8-4-2-1-3-5-9-11(8)10(14)6-7-13-9/h1-2,5,13H,3-4,6-7H2/b2-1?,9-5+,11-8- |
| InChIKey | NZHYYMNLYCTELI-BFJGIHBKSA-N |
| XLogP | 2.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|