About 7-methyl-1,2,3,7-tetrahydrocyclohepta[b]pyridin-4-one
7-methyl-1,2,3,7-tetrahydrocyclohepta[b]pyridin-4-one (PubChem CID 142873996) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 7-methyl-1,2,3,7-tetrahydrocyclohepta[b]pyridin-4-one.
Analyze 7-methyl-1,2,3,7-tetrahydrocyclohepta[b]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1,2,3,7-tetrahydrocyclohepta[b]pyridin-4-one?
The IUPAC name of 7-methyl-1,2,3,7-tetrahydrocyclohepta[b]pyridin-4-one (CID 142873996) is 7-methyl-1,2,3,7-tetrahydrocyclohepta[b]pyridin-4-one.
What is the SMILES notation for 7-methyl-1,2,3,7-tetrahydrocyclohepta[b]pyridin-4-one?
The canonical SMILES for 7-methyl-1,2,3,7-tetrahydrocyclohepta[b]pyridin-4-one is CC1C=CC2=C(C=C1)C(=O)CCN2.
What is the InChIKey of 7-methyl-1,2,3,7-tetrahydrocyclohepta[b]pyridin-4-one?
The InChIKey is PUXFXJCJNDZHRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-8-2-4-9-10(5-3-8)12-7-6-11(9)13/h2-5,8,12H,6-7H2,1H3.
What are the key properties of 7-methyl-1,2,3,7-tetrahydrocyclohepta[b]pyridin-4-one?
7-methyl-1,2,3,7-tetrahydrocyclohepta[b]pyridin-4-one has a molecular weight of 175.23 g/mol, XLogP of 1.57, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1,2,3,7-tetrahydrocyclohepta[b]pyridin-4-one is sourced from PubChem (CID 142873996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).