C13H17FN2O2 — CID 143751640
acetamide;(4aZ,10E)-5-fluoro-2,3,6,9-tetrahydro-1H-cycloocta[b]pyridin-4-one (PubChem CID 143751640) has the molecular formula C13H17FN2O2 and a molecular weight of 252.29 g/mol. Its IUPAC name is acetamide;(4aZ,10E)-5-fluoro-2,3,6,9-tetrahydro-1H-cycloocta[b]pyridin-4-one.
| Compound Name | acetamide;(4aZ,10E)-5-fluoro-2,3,6,9-tetrahydro-1H-cycloocta[b]pyridin-4-one |
|---|---|
| PubChem CID | 143751640 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | acetamide;(4aZ,10E)-5-fluoro-2,3,6,9-tetrahydro-1H-cycloocta[b]pyridin-4-one |
| SMILES | CC(N)=O.O=C1CCN/C2=C/CC=CC/C(F)=C\12 |
| InChI | InChI=1S/C11H12FNO.C2H5NO/c12-8-4-2-1-3-5-9-11(8)10(14)6-7-13-9;1-2(3)4/h1-2,5,13H,3-4,6-7H2;1H3,(H2,3,4)/b2-1?,9-5+,11-8-; |
| InChIKey | MQTPEWDNPZZQSJ-DHSYVQMNSA-N |
| XLogP | 1.50 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|