C12H15NO — CID 143107789
(2E,3E)-2-[(Z)-but-2-enylidene]-3-prop-2-enylidenepiperidin-4-one (PubChem CID 143107789) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (2E,3E)-2-[(Z)-but-2-enylidene]-3-prop-2-enylidenepiperidin-4-one.
| Compound Name | (2E,3E)-2-[(Z)-but-2-enylidene]-3-prop-2-enylidenepiperidin-4-one |
|---|---|
| PubChem CID | 143107789 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (2E,3E)-2-[(Z)-but-2-enylidene]-3-prop-2-enylidenepiperidin-4-one |
| SMILES | C=C/C=C1/C(=O)CCN/C1=C/C=C\C |
| InChI | InChI=1S/C12H15NO/c1-3-5-7-11-10(6-4-2)12(14)8-9-13-11/h3-7,13H,2,8-9H2,1H3/b5-3-,10-6+,11-7+ |
| InChIKey | SNANXWSMWQZGQG-TWCPBAAKSA-N |
| XLogP | 2.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|