About 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one
5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one (PubChem CID 85092514) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one.
Molecular Properties
| Compound Name | 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one |
| PubChem CID | 85092514 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one |
| SMILES | CC=C1C(=O)C=C2NCCC=C21 |
| InChI | InChI=1S/C10H11NO/c1-2-7-8-4-3-5-11-9(8)6-10(7)12/h2,4,6,11H,3,5H2,1H3 |
| InChIKey | RLVWTWCDRCCHFP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one?
The IUPAC name of 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one (CID 85092514) is 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one.
What is the SMILES notation for 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one?
The canonical SMILES for 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one is CC=C1C(=O)C=C2NCCC=C21.
What is the InChIKey of 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one?
The InChIKey is RLVWTWCDRCCHFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-2-7-8-4-3-5-11-9(8)6-10(7)12/h2,4,6,11H,3,5H2,1H3.
What are the key properties of 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one?
5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one has a molecular weight of 161.20 g/mol, XLogP of 1.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one is sourced from PubChem (CID 85092514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).