C10H11NO — CID 85092514
5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one (PubChem CID 85092514) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one.
| Compound Name | 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one |
|---|---|
| PubChem CID | 85092514 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one |
| SMILES | CC=C1C(=O)C=C2NCCC=C21 |
| InChI | InChI=1S/C10H11NO/c1-2-7-8-4-3-5-11-9(8)6-10(7)12/h2,4,6,11H,3,5H2,1H3 |
| InChIKey | RLVWTWCDRCCHFP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|