C17H26FNO — CID 142816315
(6E)-3-ethyl-1-(ethylamino)-6-(1-fluoroethylidene)undeca-7,8,10-trien-4-one (PubChem CID 142816315) has the molecular formula C17H26FNO and a molecular weight of 279.40 g/mol. Its IUPAC name is (6E)-3-ethyl-1-(ethylamino)-6-(1-fluoroethylidene)undeca-7,8,10-trien-4-one.
| Compound Name | (6E)-3-ethyl-1-(ethylamino)-6-(1-fluoroethylidene)undeca-7,8,10-trien-4-one |
|---|---|
| PubChem CID | 142816315 |
| Molecular Formula | C17H26FNO |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | (6E)-3-ethyl-1-(ethylamino)-6-(1-fluoroethylidene)undeca-7,8,10-trien-4-one |
| SMILES | C=CC=C=C/C(CC(=O)C(CC)CCNCC)=C(\C)F |
| InChI | InChI=1S/C17H26FNO/c1-5-8-9-10-16(14(4)18)13-17(20)15(6-2)11-12-19-7-3/h5,8,10,15,19H,1,6-7,11-13H2,2-4H3/b16-14- |
| InChIKey | KCEMDCFKMPNVEO-PEZBUJJGSA-N |
| XLogP | 4.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|