C27H41NO — CID 142767321
(4Z,7Z,10Z,13Z,16Z,19Z)-1-piperidin-4-yldocosa-4,7,10,13,16,19-hexaen-1-one (PubChem CID 142767321) has the molecular formula C27H41NO and a molecular weight of 395.63 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-1-piperidin-4-yldocosa-4,7,10,13,16,19-hexaen-1-one.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-1-piperidin-4-yldocosa-4,7,10,13,16,19-hexaen-1-one |
|---|---|
| PubChem CID | 142767321 |
| Molecular Formula | C27H41NO |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.32 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-1-piperidin-4-yldocosa-4,7,10,13,16,19-hexaen-1-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)C1CCNCC1 |
| InChI | InChI=1S/C27H41NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-27(29)26-22-24-28-25-23-26/h3-4,6-7,9-10,12-13,15-16,18-19,26,28H,2,5,8,11,14,17,20-25H2,1H3/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | IUNGJDFEHGJYSS-KUBAVDMBSA-N |
| XLogP | 7.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|